C16H17ClFNO2S2 — CID 100690126
N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-4-fluoro-2-methylbenzenesulfonamide (PubChem CID 100690126) has the molecular formula C16H17ClFNO2S2 and a molecular weight of 373.90 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-4-fluoro-2-methylbenzenesulfonamide.
| Compound Name | N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-4-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 100690126 |
| Molecular Formula | C16H17ClFNO2S2 |
| Molecular Weight | 373.90 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | N-[2-[(3-chlorophenyl)methylsulfanyl]ethyl]-4-fluoro-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)NCCSCc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H17ClFNO2S2/c1-12-9-15(18)5-6-16(12)23(20,21)19-7-8-22-11-13-3-2-4-14(17)10-13/h2-6,9-10,19H,7-8,11H2,1H3 |
| InChIKey | GDWCUFSMRFBPFK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.90 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|