C9H11Cl2NO2S — CID 60681368
N-[(3,4-dichlorophenyl)methyl]-N-methylmethanesulfonamide (PubChem CID 60681368) has the molecular formula C9H11Cl2NO2S and a molecular weight of 268.17 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N-methylmethanesulfonamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 60681368 |
| Molecular Formula | C9H11Cl2NO2S |
| Molecular Weight | 268.17 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N-methylmethanesulfonamide |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C9H11Cl2NO2S/c1-12(15(2,13)14)6-7-3-4-8(10)9(11)5-7/h3-5H,6H2,1-2H3 |
| InChIKey | APQLNLBQPLTVQR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.17 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |