C14H16ClFN2O2S — CID 75389814
1-(3-chloro-4-fluorophenyl)-N-methyl-N-[(1-methylpyrrol-2-yl)methyl]methanesulfonamide (PubChem CID 75389814) has the molecular formula C14H16ClFN2O2S and a molecular weight of 330.81 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-N-methyl-N-[(1-methylpyrrol-2-yl)methyl]methanesulfonamide.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-N-methyl-N-[(1-methylpyrrol-2-yl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 75389814 |
| Molecular Formula | C14H16ClFN2O2S |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-N-methyl-N-[(1-methylpyrrol-2-yl)methyl]methanesulfonamide |
| SMILES | CN(Cc1cccn1C)S(=O)(=O)Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H16ClFN2O2S/c1-17-7-3-4-12(17)9-18(2)21(19,20)10-11-5-6-14(16)13(15)8-11/h3-8H,9-10H2,1-2H3 |
| InChIKey | NQKKPHRBFWROQZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |