C17H20ClFN2O2S — CID 120877130
N-(2-aminoethyl)-1-(3-chloro-4-fluorophenyl)-N-(2-phenylethyl)methanesulfonamide (PubChem CID 120877130) has the molecular formula C17H20ClFN2O2S and a molecular weight of 370.88 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(3-chloro-4-fluorophenyl)-N-(2-phenylethyl)methanesulfonamide.
| Compound Name | N-(2-aminoethyl)-1-(3-chloro-4-fluorophenyl)-N-(2-phenylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 120877130 |
| Molecular Formula | C17H20ClFN2O2S |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-(2-aminoethyl)-1-(3-chloro-4-fluorophenyl)-N-(2-phenylethyl)methanesulfonamide |
| SMILES | NCCN(CCc1ccccc1)S(=O)(=O)Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H20ClFN2O2S/c18-16-12-15(6-7-17(16)19)13-24(22,23)21(11-9-20)10-8-14-4-2-1-3-5-14/h1-7,12H,8-11,13,20H2 |
| InChIKey | LWANUZUHKWHZHL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |