C18H21F3N2O2S — CID 120895456
N-(2-aminoethyl)-N-(2-phenylethyl)-1-[3-(trifluoromethyl)phenyl]methanesulfonamide (PubChem CID 120895456) has the molecular formula C18H21F3N2O2S and a molecular weight of 386.44 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-(2-phenylethyl)-1-[3-(trifluoromethyl)phenyl]methanesulfonamide.
| Compound Name | N-(2-aminoethyl)-N-(2-phenylethyl)-1-[3-(trifluoromethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 120895456 |
| Molecular Formula | C18H21F3N2O2S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-(2-aminoethyl)-N-(2-phenylethyl)-1-[3-(trifluoromethyl)phenyl]methanesulfonamide |
| SMILES | NCCN(CCc1ccccc1)S(=O)(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H21F3N2O2S/c19-18(20,21)17-8-4-7-16(13-17)14-26(24,25)23(12-10-22)11-9-15-5-2-1-3-6-15/h1-8,13H,9-12,14,22H2 |
| InChIKey | DPOGBMYHVADQAX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |