C17H22BrClN2O2S — CID 120895557
N-(2-aminoethyl)-1-(4-bromophenyl)-N-(2-phenylethyl)methanesulfonamide;hydrochloride (PubChem CID 120895557) has the molecular formula C17H22BrClN2O2S and a molecular weight of 433.80 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(4-bromophenyl)-N-(2-phenylethyl)methanesulfonamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-1-(4-bromophenyl)-N-(2-phenylethyl)methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120895557 |
| Molecular Formula | C17H22BrClN2O2S |
| Molecular Weight | 433.80 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | N-(2-aminoethyl)-1-(4-bromophenyl)-N-(2-phenylethyl)methanesulfonamide;hydrochloride |
| SMILES | Cl.NCCN(CCc1ccccc1)S(=O)(=O)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H21BrN2O2S.ClH/c18-17-8-6-16(7-9-17)14-23(21,22)20(13-11-19)12-10-15-4-2-1-3-5-15;/h1-9H,10-14,19H2;1H |
| InChIKey | PDWVCEMFUCKZFA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.80 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |