C13H9Cl2FO3S — CID 32673387
(3,4-dichlorophenyl) (4-fluorophenyl)methanesulfonate (PubChem CID 32673387) has the molecular formula C13H9Cl2FO3S and a molecular weight of 335.18 g/mol. Its IUPAC name is (3,4-dichlorophenyl) (4-fluorophenyl)methanesulfonate.
| Compound Name | (3,4-dichlorophenyl) (4-fluorophenyl)methanesulfonate |
|---|---|
| PubChem CID | 32673387 |
| Molecular Formula | C13H9Cl2FO3S |
| Molecular Weight | 335.18 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | (3,4-dichlorophenyl) (4-fluorophenyl)methanesulfonate |
| SMILES | O=S(=O)(Cc1ccc(F)cc1)Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H9Cl2FO3S/c14-12-6-5-11(7-13(12)15)19-20(17,18)8-9-1-3-10(16)4-2-9/h1-7H,8H2 |
| InChIKey | UUXMUTPVFFQNOG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.18 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|