C12H8Cl2FNO3S — CID 573189
(3,5-dichloro-2-pyridinyl) (3-fluorophenyl)methanesulfonate (PubChem CID 573189) has the molecular formula C12H8Cl2FNO3S and a molecular weight of 336.17 g/mol. Its IUPAC name is (3,5-dichloro-2-pyridinyl) (3-fluorophenyl)methanesulfonate.
| Compound Name | (3,5-dichloro-2-pyridinyl) (3-fluorophenyl)methanesulfonate |
|---|---|
| PubChem CID | 573189 |
| Molecular Formula | C12H8Cl2FNO3S |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | (3,5-dichloro-2-pyridinyl) (3-fluorophenyl)methanesulfonate |
| SMILES | O=S(=O)(Cc1cccc(F)c1)Oc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C12H8Cl2FNO3S/c13-9-5-11(14)12(16-6-9)19-20(17,18)7-8-2-1-3-10(15)4-8/h1-6H,7H2 |
| InChIKey | MMSXSSGNPYPIBT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|