C15H8F5IO2S — CID 85326572
1,2,3,4,5-pentafluoro-6-[2-[(4-iodophenyl)methylsulfonyl]ethenyl]benzene (PubChem CID 85326572) has the molecular formula C15H8F5IO2S and a molecular weight of 474.19 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[2-[(4-iodophenyl)methylsulfonyl]ethenyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[2-[(4-iodophenyl)methylsulfonyl]ethenyl]benzene |
|---|---|
| PubChem CID | 85326572 |
| Molecular Formula | C15H8F5IO2S |
| Molecular Weight | 474.19 g/mol |
| Exact Mass | 473.92 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[2-[(4-iodophenyl)methylsulfonyl]ethenyl]benzene |
| SMILES | O=S(=O)(C=Cc1c(F)c(F)c(F)c(F)c1F)Cc1ccc(I)cc1 |
| InChI | InChI=1S/C15H8F5IO2S/c16-11-10(12(17)14(19)15(20)13(11)18)5-6-24(22,23)7-8-1-3-9(21)4-2-8/h1-6H,7H2 |
| InChIKey | WQJUGIORJZOXRQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.19 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|