C15H10ClF3O2S — CID 85434227
1-[2-[(4-chlorophenyl)methylsulfonyl]ethenyl]-2,3,4-trifluorobenzene (PubChem CID 85434227) has the molecular formula C15H10ClF3O2S and a molecular weight of 346.76 g/mol. Its IUPAC name is 1-[2-[(4-chlorophenyl)methylsulfonyl]ethenyl]-2,3,4-trifluorobenzene.
| Compound Name | 1-[2-[(4-chlorophenyl)methylsulfonyl]ethenyl]-2,3,4-trifluorobenzene |
|---|---|
| PubChem CID | 85434227 |
| Molecular Formula | C15H10ClF3O2S |
| Molecular Weight | 346.76 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 1-[2-[(4-chlorophenyl)methylsulfonyl]ethenyl]-2,3,4-trifluorobenzene |
| SMILES | O=S(=O)(C=Cc1ccc(F)c(F)c1F)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H10ClF3O2S/c16-12-4-1-10(2-5-12)9-22(20,21)8-7-11-3-6-13(17)15(19)14(11)18/h1-8H,9H2 |
| InChIKey | XDWZXCYPQKIGKK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.76 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|