C29H26O9S3 — CID 175214980
[4-[[(E)-2-[3-hydroxy-4-(4-methylphenyl)sulfonyloxyphenyl]ethenyl]sulfonylmethyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 175214980) has the molecular formula C29H26O9S3 and a molecular weight of 614.72 g/mol. Its IUPAC name is [4-[[(E)-2-[3-hydroxy-4-(4-methylphenyl)sulfonyloxyphenyl]ethenyl]sulfonylmethyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[[(E)-2-[3-hydroxy-4-(4-methylphenyl)sulfonyloxyphenyl]ethenyl]sulfonylmethyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 175214980 |
| Molecular Formula | C29H26O9S3 |
| Molecular Weight | 614.72 g/mol |
| Exact Mass | 614.07 |
| IUPAC Name | [4-[[(E)-2-[3-hydroxy-4-(4-methylphenyl)sulfonyloxyphenyl]ethenyl]sulfonylmethyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(CS(=O)(=O)/C=C/c3ccc(OS(=O)(=O)c4ccc(C)cc4)c(O)c3)cc2)cc1 |
| InChI | InChI=1S/C29H26O9S3/c1-21-3-12-26(13-4-21)40(33,34)37-25-10-7-24(8-11-25)20-39(31,32)18-17-23-9-16-29(28(30)19-23)38-41(35,36)27-14-5-22(2)6-15-27/h3-19,30H,20H2,1-2H3/b18-17+ |
| InChIKey | YUOUDNPIBXXRAL-ISLYRVAYSA-N |
| XLogP | 5.13 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.72 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|