C18H20N2O8S — CID 140612812
2-methoxy-3-nitro-5-[[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]sulfonylmethyl]pyridine (PubChem CID 140612812) has the molecular formula C18H20N2O8S and a molecular weight of 424.43 g/mol. Its IUPAC name is 2-methoxy-3-nitro-5-[[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]sulfonylmethyl]pyridine.
| Compound Name | 2-methoxy-3-nitro-5-[[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]sulfonylmethyl]pyridine |
|---|---|
| PubChem CID | 140612812 |
| Molecular Formula | C18H20N2O8S |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 2-methoxy-3-nitro-5-[[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]sulfonylmethyl]pyridine |
| SMILES | COc1ccc(/C=C/S(=O)(=O)Cc2cnc(OC)c([N+](=O)[O-])c2)c(OC)c1OC |
| InChI | InChI=1S/C18H20N2O8S/c1-25-15-6-5-13(16(26-2)17(15)27-3)7-8-29(23,24)11-12-9-14(20(21)22)18(28-4)19-10-12/h5-10H,11H2,1-4H3/b8-7+ |
| InChIKey | QBSSSMVBSXKMMD-BQYQJAHWSA-N |
| XLogP | 2.61 |
| TPSA | 127.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|