C17H17NO7S — CID 9036121
1,2,3-trimethoxy-4-[(E)-2-(4-nitrophenyl)sulfonylethenyl]benzene (PubChem CID 9036121) has the molecular formula C17H17NO7S and a molecular weight of 379.39 g/mol. Its IUPAC name is 1,2,3-trimethoxy-4-[(E)-2-(4-nitrophenyl)sulfonylethenyl]benzene.
| Compound Name | 1,2,3-trimethoxy-4-[(E)-2-(4-nitrophenyl)sulfonylethenyl]benzene |
|---|---|
| PubChem CID | 9036121 |
| Molecular Formula | C17H17NO7S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 1,2,3-trimethoxy-4-[(E)-2-(4-nitrophenyl)sulfonylethenyl]benzene |
| SMILES | COc1ccc(/C=C/S(=O)(=O)c2ccc([N+](=O)[O-])cc2)c(OC)c1OC |
| InChI | InChI=1S/C17H17NO7S/c1-23-15-9-4-12(16(24-2)17(15)25-3)10-11-26(21,22)14-7-5-13(6-8-14)18(19)20/h4-11H,1-3H3/b11-10+ |
| InChIKey | SBAJYMBEYIJDIE-ZHACJKMWSA-N |
| XLogP | 3.07 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|