C17H16N2O4 — CID 4102744
N-(2,5-dimethoxyphenyl)-3-(4-nitrophenyl)prop-2-en-1-imine (PubChem CID 4102744) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-3-(4-nitrophenyl)prop-2-en-1-imine.
| Compound Name | N-(2,5-dimethoxyphenyl)-3-(4-nitrophenyl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 4102744 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-3-(4-nitrophenyl)prop-2-en-1-imine |
| SMILES | COc1ccc(OC)c(/N=C/C=Cc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C17H16N2O4/c1-22-15-9-10-17(23-2)16(12-15)18-11-3-4-13-5-7-14(8-6-13)19(20)21/h3-12H,1-2H3/b4-3?,18-11+ |
| InChIKey | FAXSYGYUIIACTI-KDSRJHGISA-N |
| XLogP | 4.03 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|