C31H40ClN3O7 — CID 70063996
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-4-nitrobenzamide;hydrochloride (PubChem CID 70063996) has the molecular formula C31H40ClN3O7 and a molecular weight of 602.13 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-4-nitrobenzamide;hydrochloride.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-4-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 70063996 |
| Molecular Formula | C31H40ClN3O7 |
| Molecular Weight | 602.13 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-4-nitrobenzamide;hydrochloride |
| SMILES | COc1ccc(CCN(C)CCCN(CCc2ccc(OC)c(OC)c2)C(=O)c2ccc([N+](=O)[O-])cc2)cc1OC.Cl |
| InChI | InChI=1S/C31H39N3O7.ClH/c1-32(19-15-23-7-13-27(38-2)29(21-23)40-4)17-6-18-33(31(35)25-9-11-26(12-10-25)34(36)37)20-16-24-8-14-28(39-3)30(22-24)41-5;/h7-14,21-22H,6,15-20H2,1-5H3;1H |
| InChIKey | KUAJXWGSHNIWLT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 103.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.13 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|