C30H38ClN3O7 — CID 139720709
N-(3,4-dimethoxyphenyl)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-2-(4-nitrophenyl)acetamide;hydrochloride (PubChem CID 139720709) has the molecular formula C30H38ClN3O7 and a molecular weight of 588.10 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-2-(4-nitrophenyl)acetamide;hydrochloride.
| Compound Name | N-(3,4-dimethoxyphenyl)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-2-(4-nitrophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 139720709 |
| Molecular Formula | C30H38ClN3O7 |
| Molecular Weight | 588.10 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-2-(4-nitrophenyl)acetamide;hydrochloride |
| SMILES | COc1ccc(CCN(C)CCCN(C(=O)Cc2ccc([N+](=O)[O-])cc2)c2ccc(OC)c(OC)c2)cc1OC.Cl |
| InChI | InChI=1S/C30H37N3O7.ClH/c1-31(18-15-23-9-13-26(37-2)28(19-23)39-4)16-6-17-32(25-12-14-27(38-3)29(21-25)40-5)30(34)20-22-7-10-24(11-8-22)33(35)36;/h7-14,19,21H,6,15-18,20H2,1-5H3;1H |
| InChIKey | XEYHMMGBDWTVKR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 103.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.10 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|