C24H33ClN2O8S2 — CID 88806286
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-[2-(3-nitrophenyl)-1,1,3,3-tetraoxo-1,3-dithian-2-yl]propan-1-amine;hydrochloride (PubChem CID 88806286) has the molecular formula C24H33ClN2O8S2 and a molecular weight of 577.12 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-[2-(3-nitrophenyl)-1,1,3,3-tetraoxo-1,3-dithian-2-yl]propan-1-amine;hydrochloride.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-[2-(3-nitrophenyl)-1,1,3,3-tetraoxo-1,3-dithian-2-yl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 88806286 |
| Molecular Formula | C24H33ClN2O8S2 |
| Molecular Weight | 577.12 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-[2-(3-nitrophenyl)-1,1,3,3-tetraoxo-1,3-dithian-2-yl]propan-1-amine;hydrochloride |
| SMILES | COc1ccc(CCN(C)CCCC2(c3cccc([N+](=O)[O-])c3)S(=O)(=O)CCCS2(=O)=O)cc1OC.Cl |
| InChI | InChI=1S/C24H32N2O8S2.ClH/c1-25(14-11-19-9-10-22(33-2)23(17-19)34-3)13-5-12-24(20-7-4-8-21(18-20)26(27)28)35(29,30)15-6-16-36(24,31)32;/h4,7-10,17-18H,5-6,11-16H2,1-3H3;1H |
| InChIKey | WFZMMNYCJIARKN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.12 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|