C28H41NO8S2 — CID 88806730
N-[2-(3,4-dimethoxyphenyl)ethyl]-5-[2-(3,4-dimethoxyphenyl)-1,1,3,3-tetraoxo-1,3-dithian-2-yl]-N-methylpentan-1-amine (PubChem CID 88806730) has the molecular formula C28H41NO8S2 and a molecular weight of 583.77 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-5-[2-(3,4-dimethoxyphenyl)-1,1,3,3-tetraoxo-1,3-dithian-2-yl]-N-methylpentan-1-amine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-5-[2-(3,4-dimethoxyphenyl)-1,1,3,3-tetraoxo-1,3-dithian-2-yl]-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 88806730 |
| Molecular Formula | C28H41NO8S2 |
| Molecular Weight | 583.77 g/mol |
| Exact Mass | 583.23 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-5-[2-(3,4-dimethoxyphenyl)-1,1,3,3-tetraoxo-1,3-dithian-2-yl]-N-methylpentan-1-amine |
| SMILES | COc1ccc(CCN(C)CCCCCC2(c3ccc(OC)c(OC)c3)S(=O)(=O)CCCS2(=O)=O)cc1OC |
| InChI | InChI=1S/C28H41NO8S2/c1-29(17-14-22-10-12-24(34-2)26(20-22)36-4)16-8-6-7-15-28(38(30,31)18-9-19-39(28,32)33)23-11-13-25(35-3)27(21-23)37-5/h10-13,20-21H,6-9,14-19H2,1-5H3 |
| InChIKey | QDRUSAJQACXJRH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.77 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|