C26H35NO8S2 — CID 88806816
3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,1,3,3-tetraoxo-1,3-dithian-2-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpropan-1-amine (PubChem CID 88806816) has the molecular formula C26H35NO8S2 and a molecular weight of 553.70 g/mol. Its IUPAC name is 3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,1,3,3-tetraoxo-1,3-dithian-2-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpropan-1-amine.
| Compound Name | 3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,1,3,3-tetraoxo-1,3-dithian-2-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 88806816 |
| Molecular Formula | C26H35NO8S2 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | 3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,1,3,3-tetraoxo-1,3-dithian-2-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpropan-1-amine |
| SMILES | COc1ccc(CCN(C)CCCC2(c3ccc4c(c3)OCCO4)S(=O)(=O)CCCS2(=O)=O)cc1OC |
| InChI | InChI=1S/C26H35NO8S2/c1-27(13-10-20-6-8-22(32-2)24(18-20)33-3)12-4-11-26(36(28,29)16-5-17-37(26,30)31)21-7-9-23-25(19-21)35-15-14-34-23/h6-9,18-19H,4-5,10-17H2,1-3H3 |
| InChIKey | SLBOLGBJQKQSAA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |