C28H36NO7P — CID 70406661
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-(3-phenyl-2H-1-benzofuran-3-yl)propan-1-amine;phosphoric acid (PubChem CID 70406661) has the molecular formula C28H36NO7P and a molecular weight of 529.57 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-(3-phenyl-2H-1-benzofuran-3-yl)propan-1-amine;phosphoric acid.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-(3-phenyl-2H-1-benzofuran-3-yl)propan-1-amine;phosphoric acid |
|---|---|
| PubChem CID | 70406661 |
| Molecular Formula | C28H36NO7P |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-(3-phenyl-2H-1-benzofuran-3-yl)propan-1-amine;phosphoric acid |
| SMILES | COc1ccc(CCN(C)CCCC2(c3ccccc3)COc3ccccc32)cc1OC.O=P(O)(O)O |
| InChI | InChI=1S/C28H33NO3.H3O4P/c1-29(19-16-22-14-15-26(30-2)27(20-22)31-3)18-9-17-28(23-10-5-4-6-11-23)21-32-25-13-8-7-12-24(25)28;1-5(2,3)4/h4-8,10-15,20H,9,16-19,21H2,1-3H3;(H3,1,2,3,4) |
| InChIKey | YESXZQCQFGIRGD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|