C34H45N3O7 — CID 139720700
N-(3,4-diethoxyphenyl)-N-[3-[2-(3,4-diethoxyphenyl)ethyl-methylamino]propyl]-2-(4-nitrophenyl)acetamide (PubChem CID 139720700) has the molecular formula C34H45N3O7 and a molecular weight of 607.75 g/mol. Its IUPAC name is N-(3,4-diethoxyphenyl)-N-[3-[2-(3,4-diethoxyphenyl)ethyl-methylamino]propyl]-2-(4-nitrophenyl)acetamide.
| Compound Name | N-(3,4-diethoxyphenyl)-N-[3-[2-(3,4-diethoxyphenyl)ethyl-methylamino]propyl]-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 139720700 |
| Molecular Formula | C34H45N3O7 |
| Molecular Weight | 607.75 g/mol |
| Exact Mass | 607.33 |
| IUPAC Name | N-(3,4-diethoxyphenyl)-N-[3-[2-(3,4-diethoxyphenyl)ethyl-methylamino]propyl]-2-(4-nitrophenyl)acetamide |
| SMILES | CCOc1ccc(CCN(C)CCCN(C(=O)Cc2ccc([N+](=O)[O-])cc2)c2ccc(OCC)c(OCC)c2)cc1OCC |
| InChI | InChI=1S/C34H45N3O7/c1-6-41-30-17-13-27(23-32(30)43-8-3)19-22-35(5)20-10-21-36(29-16-18-31(42-7-2)33(25-29)44-9-4)34(38)24-26-11-14-28(15-12-26)37(39)40/h11-18,23,25H,6-10,19-22,24H2,1-5H3 |
| InChIKey | IIKHAGYLZOVHPY-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 103.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.75 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|