C27H31N3O7 — CID 100949271
N-[3-(3,4-dimethoxy-N-methylanilino)propyl]-N-(3,4-dimethoxyphenyl)-4-nitrobenzamide (PubChem CID 100949271) has the molecular formula C27H31N3O7 and a molecular weight of 509.56 g/mol. Its IUPAC name is N-[3-(3,4-dimethoxy-N-methylanilino)propyl]-N-(3,4-dimethoxyphenyl)-4-nitrobenzamide.
| Compound Name | N-[3-(3,4-dimethoxy-N-methylanilino)propyl]-N-(3,4-dimethoxyphenyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 100949271 |
| Molecular Formula | C27H31N3O7 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | N-[3-(3,4-dimethoxy-N-methylanilino)propyl]-N-(3,4-dimethoxyphenyl)-4-nitrobenzamide |
| SMILES | COc1ccc(N(C)CCCN(C(=O)c2ccc([N+](=O)[O-])cc2)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C27H31N3O7/c1-28(21-11-13-23(34-2)25(17-21)36-4)15-6-16-29(22-12-14-24(35-3)26(18-22)37-5)27(31)19-7-9-20(10-8-19)30(32)33/h7-14,17-18H,6,15-16H2,1-5H3 |
| InChIKey | CATMUINYHYZIPD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 103.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|