C19H21NO6 — CID 119186551
4-[(3,4-dimethoxyphenyl)-(2-methoxyethyl)carbamoyl]benzoic acid (PubChem CID 119186551) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)-(2-methoxyethyl)carbamoyl]benzoic acid.
| Compound Name | 4-[(3,4-dimethoxyphenyl)-(2-methoxyethyl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 119186551 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 4-[(3,4-dimethoxyphenyl)-(2-methoxyethyl)carbamoyl]benzoic acid |
| SMILES | COCCN(C(=O)c1ccc(C(=O)O)cc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H21NO6/c1-24-11-10-20(15-8-9-16(25-2)17(12-15)26-3)18(21)13-4-6-14(7-5-13)19(22)23/h4-9,12H,10-11H2,1-3H3,(H,22,23) |
| InChIKey | HAULTFIIJZUOGC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |