C16H16N2O6 — CID 44721649
2-(3,4-dimethoxy-N-methylanilino)-4-nitrobenzoic acid (PubChem CID 44721649) has the molecular formula C16H16N2O6 and a molecular weight of 332.31 g/mol. Its IUPAC name is 2-(3,4-dimethoxy-N-methylanilino)-4-nitrobenzoic acid.
| Compound Name | 2-(3,4-dimethoxy-N-methylanilino)-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 44721649 |
| Molecular Formula | C16H16N2O6 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-(3,4-dimethoxy-N-methylanilino)-4-nitrobenzoic acid |
| SMILES | COc1ccc(N(C)c2cc([N+](=O)[O-])ccc2C(=O)O)cc1OC |
| InChI | InChI=1S/C16H16N2O6/c1-17(10-5-7-14(23-2)15(9-10)24-3)13-8-11(18(21)22)4-6-12(13)16(19)20/h4-9H,1-3H3,(H,19,20) |
| InChIKey | GDBOICWCDAMJNY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|