C29H33N3O7 — CID 67756280
N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-N-(3,4-dimethoxyphenyl)-4-nitrobenzamide (PubChem CID 67756280) has the molecular formula C29H33N3O7 and a molecular weight of 535.60 g/mol. Its IUPAC name is N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-N-(3,4-dimethoxyphenyl)-4-nitrobenzamide.
| Compound Name | N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-N-(3,4-dimethoxyphenyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 67756280 |
| Molecular Formula | C29H33N3O7 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-N-(3,4-dimethoxyphenyl)-4-nitrobenzamide |
| SMILES | COc1ccc(N(CCCN2CCc3cc(OC)c(OC)cc3C2)C(=O)c2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C29H33N3O7/c1-36-25-11-10-24(18-28(25)39-4)31(29(33)20-6-8-23(9-7-20)32(34)35)14-5-13-30-15-12-21-16-26(37-2)27(38-3)17-22(21)19-30/h6-11,16-18H,5,12-15,19H2,1-4H3 |
| InChIKey | DXJHBWNKZBTHAT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 103.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|