C28H33N3O8 — CID 54503176
N-(3,4-dimethoxyphenyl)-N-[3-(7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)propyl]-5-nitrofuran-2-carboxamide (PubChem CID 54503176) has the molecular formula C28H33N3O8 and a molecular weight of 539.59 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-N-[3-(7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)propyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-N-[3-(7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)propyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 54503176 |
| Molecular Formula | C28H33N3O8 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-N-[3-(7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)propyl]-5-nitrofuran-2-carboxamide |
| SMILES | COc1ccc(N(CCCN2CCc3cc(OC)c(OC)cc3CC2)C(=O)c2ccc([N+](=O)[O-])o2)cc1OC |
| InChI | InChI=1S/C28H33N3O8/c1-35-22-7-6-21(18-26(22)38-4)30(28(32)23-8-9-27(39-23)31(33)34)13-5-12-29-14-10-19-16-24(36-2)25(37-3)17-20(19)11-15-29/h6-9,16-18H,5,10-15H2,1-4H3 |
| InChIKey | YDWGNANXCBIQLJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 116.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|