C19H19ClN4O5S — CID 18581664
N-(4-chloro-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-5-nitrofuran-2-carboxamide (PubChem CID 18581664) has the molecular formula C19H19ClN4O5S and a molecular weight of 450.90 g/mol. Its IUPAC name is N-(4-chloro-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-5-nitrofuran-2-carboxamide.
| Compound Name | N-(4-chloro-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 18581664 |
| Molecular Formula | C19H19ClN4O5S |
| Molecular Weight | 450.90 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | N-(4-chloro-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-5-nitrofuran-2-carboxamide |
| SMILES | O=C(c1ccc([N+](=O)[O-])o1)N(CCCN1CCOCC1)c1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C19H19ClN4O5S/c20-13-3-1-4-15-17(13)21-19(30-15)23(8-2-7-22-9-11-28-12-10-22)18(25)14-5-6-16(29-14)24(26)27/h1,3-6H,2,7-12H2 |
| InChIKey | JMOXXVNIMWTQBM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 101.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.90 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|