C21H25ClN4O6S — CID 18581656
N-(4-ethoxy-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-5-nitrofuran-2-carboxamide;hydrochloride (PubChem CID 18581656) has the molecular formula C21H25ClN4O6S and a molecular weight of 496.97 g/mol. Its IUPAC name is N-(4-ethoxy-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-5-nitrofuran-2-carboxamide;hydrochloride.
| Compound Name | N-(4-ethoxy-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-5-nitrofuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 18581656 |
| Molecular Formula | C21H25ClN4O6S |
| Molecular Weight | 496.97 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | N-(4-ethoxy-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-5-nitrofuran-2-carboxamide;hydrochloride |
| SMILES | CCOc1cccc2sc(N(CCCN3CCOCC3)C(=O)c3ccc([N+](=O)[O-])o3)nc12.Cl |
| InChI | InChI=1S/C21H24N4O6S.ClH/c1-2-30-15-5-3-6-17-19(15)22-21(32-17)24(10-4-9-23-11-13-29-14-12-23)20(26)16-7-8-18(31-16)25(27)28;/h3,5-8H,2,4,9-14H2,1H3;1H |
| InChIKey | UCCXCBQJIURZET-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 111.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.97 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|