C20H22N4O6S — CID 29137996
N-(6-ethoxy-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-5-nitrofuran-2-carboxamide (PubChem CID 29137996) has the molecular formula C20H22N4O6S and a molecular weight of 446.49 g/mol. Its IUPAC name is N-(6-ethoxy-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-5-nitrofuran-2-carboxamide.
| Compound Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 29137996 |
| Molecular Formula | C20H22N4O6S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-5-nitrofuran-2-carboxamide |
| SMILES | CCOc1ccc2nc(N(CCN3CCOCC3)C(=O)c3ccc([N+](=O)[O-])o3)sc2c1 |
| InChI | InChI=1S/C20H22N4O6S/c1-2-29-14-3-4-15-17(13-14)31-20(21-15)23(8-7-22-9-11-28-12-10-22)19(25)16-5-6-18(30-16)24(26)27/h3-6,13H,2,7-12H2,1H3 |
| InChIKey | PSVDQJFRMLELLM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 111.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|