C18H17FN4O5S — CID 29138125
N-(6-fluoro-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-5-nitrofuran-2-carboxamide (PubChem CID 29138125) has the molecular formula C18H17FN4O5S and a molecular weight of 420.42 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-5-nitrofuran-2-carboxamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 29138125 |
| Molecular Formula | C18H17FN4O5S |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-5-nitrofuran-2-carboxamide |
| SMILES | O=C(c1ccc([N+](=O)[O-])o1)N(CCN1CCOCC1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C18H17FN4O5S/c19-12-1-2-13-15(11-12)29-18(20-13)22(6-5-21-7-9-27-10-8-21)17(24)14-3-4-16(28-14)23(25)26/h1-4,11H,5-10H2 |
| InChIKey | OYVZCRNDSAFPMI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 101.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|