C17H10FN3O5S — CID 30707728
N-(6-fluoro-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-5-nitrofuran-2-carboxamide (PubChem CID 30707728) has the molecular formula C17H10FN3O5S and a molecular weight of 387.35 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-5-nitrofuran-2-carboxamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 30707728 |
| Molecular Formula | C17H10FN3O5S |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-5-nitrofuran-2-carboxamide |
| SMILES | O=C(c1ccc([N+](=O)[O-])o1)N(Cc1ccco1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C17H10FN3O5S/c18-10-3-4-12-14(8-10)27-17(19-12)20(9-11-2-1-7-25-11)16(22)13-5-6-15(26-13)21(23)24/h1-8H,9H2 |
| InChIKey | DKIDFAYLJVMKLC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 102.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|