C20H17N3O5S — CID 16938918
N-(furan-2-ylmethyl)-5-nitro-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)furan-2-carboxamide (PubChem CID 16938918) has the molecular formula C20H17N3O5S and a molecular weight of 411.44 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-5-nitro-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)furan-2-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-5-nitro-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 16938918 |
| Molecular Formula | C20H17N3O5S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | N-(furan-2-ylmethyl)-5-nitro-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)furan-2-carboxamide |
| SMILES | CC(C)c1cccc2sc(N(Cc3ccco3)C(=O)c3ccc([N+](=O)[O-])o3)nc12 |
| InChI | InChI=1S/C20H17N3O5S/c1-12(2)14-6-3-7-16-18(14)21-20(29-16)22(11-13-5-4-10-27-13)19(24)15-8-9-17(28-15)23(25)26/h3-10,12H,11H2,1-2H3 |
| InChIKey | APKLTNBHNSXQGN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 102.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|