C18H12ClN3O6S — CID 30712721
N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-5-nitrofuran-2-carboxamide (PubChem CID 30712721) has the molecular formula C18H12ClN3O6S and a molecular weight of 433.83 g/mol. Its IUPAC name is N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-5-nitrofuran-2-carboxamide.
| Compound Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 30712721 |
| Molecular Formula | C18H12ClN3O6S |
| Molecular Weight | 433.83 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-5-nitrofuran-2-carboxamide |
| SMILES | COc1ccc(Cl)c2sc(N(Cc3ccco3)C(=O)c3ccc([N+](=O)[O-])o3)nc12 |
| InChI | InChI=1S/C18H12ClN3O6S/c1-26-12-5-4-11(19)16-15(12)20-18(29-16)21(9-10-3-2-8-27-10)17(23)13-6-7-14(28-13)22(24)25/h2-8H,9H2,1H3 |
| InChIKey | ACHGOSDIKDARNP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 111.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.83 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|