C22H16Cl2N2O3S — CID 30712768
(E)-N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-3-(2-chlorophenyl)-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 30712768) has the molecular formula C22H16Cl2N2O3S and a molecular weight of 459.35 g/mol. Its IUPAC name is (E)-N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-3-(2-chlorophenyl)-N-(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-3-(2-chlorophenyl)-N-(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 30712768 |
| Molecular Formula | C22H16Cl2N2O3S |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | (E)-N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-3-(2-chlorophenyl)-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | COc1ccc(Cl)c2sc(N(Cc3ccco3)C(=O)/C=C/c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C22H16Cl2N2O3S/c1-28-18-10-9-17(24)21-20(18)25-22(30-21)26(13-15-6-4-12-29-15)19(27)11-8-14-5-2-3-7-16(14)23/h2-12H,13H2,1H3/b11-8+ |
| InChIKey | YOJSFVBNDKOYGB-DHZHZOJOSA-N |
| XLogP | 6.45 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|