C25H21ClN2O3S — CID 41115408
(E)-N-benzyl-3-(2-chlorophenyl)-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 41115408) has the molecular formula C25H21ClN2O3S and a molecular weight of 464.97 g/mol. Its IUPAC name is (E)-N-benzyl-3-(2-chlorophenyl)-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-N-benzyl-3-(2-chlorophenyl)-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 41115408 |
| Molecular Formula | C25H21ClN2O3S |
| Molecular Weight | 464.97 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | (E)-N-benzyl-3-(2-chlorophenyl)-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | COc1ccc(OC)c2sc(N(Cc3ccccc3)C(=O)/C=C/c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C25H21ClN2O3S/c1-30-20-13-14-21(31-2)24-23(20)27-25(32-24)28(16-17-8-4-3-5-9-17)22(29)15-12-18-10-6-7-11-19(18)26/h3-15H,16H2,1-2H3/b15-12+ |
| InChIKey | FIOAMDJOOCNTPE-NTCAYCPXSA-N |
| XLogP | 6.21 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.97 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|