C24H26ClN3O3S — CID 29138545
(E)-3-(2-chlorophenyl)-N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)prop-2-enamide (PubChem CID 29138545) has the molecular formula C24H26ClN3O3S and a molecular weight of 472.01 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 29138545 |
| Molecular Formula | C24H26ClN3O3S |
| Molecular Weight | 472.01 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)prop-2-enamide |
| SMILES | COc1ccc(C)c2sc(N(CCN3CCOCC3)C(=O)/C=C/c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C24H26ClN3O3S/c1-17-7-9-20(30-2)22-23(17)32-24(26-22)28(12-11-27-13-15-31-16-14-27)21(29)10-8-18-5-3-4-6-19(18)25/h3-10H,11-16H2,1-2H3/b10-8+ |
| InChIKey | IDGZYQLIOQFNJE-CSKARUKUSA-N |
| XLogP | 4.65 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.01 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|