C24H20ClN3OS — CID 41016688
(E)-3-(2-chlorophenyl)-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)prop-2-enamide (PubChem CID 41016688) has the molecular formula C24H20ClN3OS and a molecular weight of 433.96 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 41016688 |
| Molecular Formula | C24H20ClN3OS |
| Molecular Weight | 433.96 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)prop-2-enamide |
| SMILES | Cc1cc2nc(N(Cc3cccnc3)C(=O)/C=C/c3ccccc3Cl)sc2cc1C |
| InChI | InChI=1S/C24H20ClN3OS/c1-16-12-21-22(13-17(16)2)30-24(27-21)28(15-18-6-5-11-26-14-18)23(29)10-9-19-7-3-4-8-20(19)25/h3-14H,15H2,1-2H3/b10-9+ |
| InChIKey | SSLZFSVGXRJJEU-MDZDMXLPSA-N |
| XLogP | 6.21 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.96 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|