C23H18ClN3O3S2 — CID 71961923
3-(2-chlorophenyl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)prop-2-enamide (PubChem CID 71961923) has the molecular formula C23H18ClN3O3S2 and a molecular weight of 484.00 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 71961923 |
| Molecular Formula | C23H18ClN3O3S2 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | 3-(2-chlorophenyl)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1ccc2nc(N(Cc3cccnc3)C(=O)C=Cc3ccccc3Cl)sc2c1 |
| InChI | InChI=1S/C23H18ClN3O3S2/c1-32(29,30)18-9-10-20-21(13-18)31-23(26-20)27(15-16-5-4-12-25-14-16)22(28)11-8-17-6-2-3-7-19(17)24/h2-14H,15H2,1H3 |
| InChIKey | GOJGFFUFJOWKFL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|