C29H35N3O6S — CID 3301127
N-[2-[2-(3,4-dimethoxyphenyl)ethyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(2-methylpropyl)-4-nitrobenzamide (PubChem CID 3301127) has the molecular formula C29H35N3O6S and a molecular weight of 553.68 g/mol. Its IUPAC name is N-[2-[2-(3,4-dimethoxyphenyl)ethyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(2-methylpropyl)-4-nitrobenzamide.
| Compound Name | N-[2-[2-(3,4-dimethoxyphenyl)ethyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(2-methylpropyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 3301127 |
| Molecular Formula | C29H35N3O6S |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | N-[2-[2-(3,4-dimethoxyphenyl)ethyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(2-methylpropyl)-4-nitrobenzamide |
| SMILES | COc1ccc(CCN(Cc2sccc2C)C(=O)CN(CC(C)C)C(=O)c2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C29H35N3O6S/c1-20(2)17-31(29(34)23-7-9-24(10-8-23)32(35)36)19-28(33)30(18-27-21(3)13-15-39-27)14-12-22-6-11-25(37-4)26(16-22)38-5/h6-11,13,15-16,20H,12,14,17-19H2,1-5H3 |
| InChIKey | IFRKMIMMFCQNOR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|