C32H40N4O6S — CID 4509151
N-[2-[2-(3,4-dimethoxyphenyl)ethyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-(2-pyrrolidin-1-ylethyl)benzamide (PubChem CID 4509151) has the molecular formula C32H40N4O6S and a molecular weight of 608.76 g/mol. Its IUPAC name is N-[2-[2-(3,4-dimethoxyphenyl)ethyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-(2-pyrrolidin-1-ylethyl)benzamide.
| Compound Name | N-[2-[2-(3,4-dimethoxyphenyl)ethyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-(2-pyrrolidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 4509151 |
| Molecular Formula | C32H40N4O6S |
| Molecular Weight | 608.76 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | N-[2-[2-(3,4-dimethoxyphenyl)ethyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-(2-pyrrolidin-1-ylethyl)benzamide |
| SMILES | COc1ccc(CCN(Cc2sccc2C)C(=O)CN(CCN2CCCC2)C(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C32H40N4O6S/c1-23-7-9-26(20-27(23)36(39)40)32(38)35(17-16-33-13-5-6-14-33)22-31(37)34(21-30-24(2)12-18-43-30)15-11-25-8-10-28(41-3)29(19-25)42-4/h7-10,12,18-20H,5-6,11,13-17,21-22H2,1-4H3 |
| InChIKey | LRQSBHIHIBBCFN-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 105.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.76 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|