C28H35N3O8S2 — CID 3274599
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[3-methoxypropyl-(4-nitrophenyl)sulfonylamino]-N-[(3-methylthiophen-2-yl)methyl]acetamide (PubChem CID 3274599) has the molecular formula C28H35N3O8S2 and a molecular weight of 605.74 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[3-methoxypropyl-(4-nitrophenyl)sulfonylamino]-N-[(3-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[3-methoxypropyl-(4-nitrophenyl)sulfonylamino]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 3274599 |
| Molecular Formula | C28H35N3O8S2 |
| Molecular Weight | 605.74 g/mol |
| Exact Mass | 605.19 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[3-methoxypropyl-(4-nitrophenyl)sulfonylamino]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
| SMILES | COCCCN(CC(=O)N(CCc1ccc(OC)c(OC)c1)Cc1sccc1C)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H35N3O8S2/c1-21-13-17-40-27(21)19-29(15-12-22-6-11-25(38-3)26(18-22)39-4)28(32)20-30(14-5-16-37-2)41(35,36)24-9-7-23(8-10-24)31(33)34/h6-11,13,17-18H,5,12,14-16,19-20H2,1-4H3 |
| InChIKey | AGJJFVJVQSLOPX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 128.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.74 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|