C18H14F5NO5S — CID 91199805
2-[(3,4-dimethoxyphenyl)methylsulfonyl]-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide (PubChem CID 91199805) has the molecular formula C18H14F5NO5S and a molecular weight of 451.37 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methylsulfonyl]-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methylsulfonyl]-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 91199805 |
| Molecular Formula | C18H14F5NO5S |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methylsulfonyl]-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide |
| SMILES | COc1ccc(CS(=O)(=O)C(=Cc2c(F)c(F)c(F)c(F)c2F)C(N)=O)cc1OC |
| InChI | InChI=1S/C18H14F5NO5S/c1-28-10-4-3-8(5-11(10)29-2)7-30(26,27)12(18(24)25)6-9-13(19)15(21)17(23)16(22)14(9)20/h3-6H,7H2,1-2H3,(H2,24,25) |
| InChIKey | UUBGKCNCYSSQLH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|