C14H20O6S — CID 105354511
2-[(3,4-dimethoxyphenyl)methylsulfonyl]-3-methylbutanoic acid (PubChem CID 105354511) has the molecular formula C14H20O6S and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methylsulfonyl]-3-methylbutanoic acid.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methylsulfonyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 105354511 |
| Molecular Formula | C14H20O6S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methylsulfonyl]-3-methylbutanoic acid |
| SMILES | COc1ccc(CS(=O)(=O)C(C(=O)O)C(C)C)cc1OC |
| InChI | InChI=1S/C14H20O6S/c1-9(2)13(14(15)16)21(17,18)8-10-5-6-11(19-3)12(7-10)20-4/h5-7,9,13H,8H2,1-4H3,(H,15,16) |
| InChIKey | NXAXTOWRRLPFFT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |