C12H14F2O4S — CID 105354520
2-[(2,5-difluorophenyl)methylsulfonyl]-3-methylbutanoic acid (PubChem CID 105354520) has the molecular formula C12H14F2O4S and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methylsulfonyl]-3-methylbutanoic acid.
| Compound Name | 2-[(2,5-difluorophenyl)methylsulfonyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 105354520 |
| Molecular Formula | C12H14F2O4S |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methylsulfonyl]-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)S(=O)(=O)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C12H14F2O4S/c1-7(2)11(12(15)16)19(17,18)6-8-5-9(13)3-4-10(8)14/h3-5,7,11H,6H2,1-2H3,(H,15,16) |
| InChIKey | GRFKHIHZTMWBPZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |