C10H12F2O3S — CID 167861817
1-[(2,5-difluorophenyl)methylsulfonyl]propan-2-ol (PubChem CID 167861817) has the molecular formula C10H12F2O3S and a molecular weight of 250.27 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methylsulfonyl]propan-2-ol.
| Compound Name | 1-[(2,5-difluorophenyl)methylsulfonyl]propan-2-ol |
|---|---|
| PubChem CID | 167861817 |
| Molecular Formula | C10H12F2O3S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methylsulfonyl]propan-2-ol |
| SMILES | CC(O)CS(=O)(=O)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C10H12F2O3S/c1-7(13)5-16(14,15)6-8-4-9(11)2-3-10(8)12/h2-4,7,13H,5-6H2,1H3 |
| InChIKey | FXSBLHFEUINCOY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |