C11H13FO5S — CID 43332376
2-[(3-fluoro-4-methoxyphenyl)methylsulfonyl]propanoic acid (PubChem CID 43332376) has the molecular formula C11H13FO5S and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-[(3-fluoro-4-methoxyphenyl)methylsulfonyl]propanoic acid.
| Compound Name | 2-[(3-fluoro-4-methoxyphenyl)methylsulfonyl]propanoic acid |
|---|---|
| PubChem CID | 43332376 |
| Molecular Formula | C11H13FO5S |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 2-[(3-fluoro-4-methoxyphenyl)methylsulfonyl]propanoic acid |
| SMILES | COc1ccc(CS(=O)(=O)C(C)C(=O)O)cc1F |
| InChI | InChI=1S/C11H13FO5S/c1-7(11(13)14)18(15,16)6-8-3-4-10(17-2)9(12)5-8/h3-5,7H,6H2,1-2H3,(H,13,14) |
| InChIKey | XCQMGLBIEOWMDB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |