C17H12F5NO6S — CID 87630680
1-[(Z)-2-[(3,4-dimethoxyphenyl)methylsulfonyl]-2-nitroethenyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 87630680) has the molecular formula C17H12F5NO6S and a molecular weight of 453.34 g/mol. Its IUPAC name is 1-[(Z)-2-[(3,4-dimethoxyphenyl)methylsulfonyl]-2-nitroethenyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[(Z)-2-[(3,4-dimethoxyphenyl)methylsulfonyl]-2-nitroethenyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 87630680 |
| Molecular Formula | C17H12F5NO6S |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | 1-[(Z)-2-[(3,4-dimethoxyphenyl)methylsulfonyl]-2-nitroethenyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | COc1ccc(CS(=O)(=O)/C(=C\c2c(F)c(F)c(F)c(F)c2F)[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H12F5NO6S/c1-28-10-4-3-8(5-11(10)29-2)7-30(26,27)12(23(24)25)6-9-13(18)15(20)17(22)16(21)14(9)19/h3-6H,7H2,1-2H3/b12-6- |
| InChIKey | LQAIYNJFYLMULJ-SDQBBNPISA-N |
| XLogP | 3.59 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|