C18H18FNO7S — CID 68949558
2-[2-[(4-fluorophenyl)methylsulfonyl]-2-nitroethenyl]-1,3,5-trimethoxybenzene (PubChem CID 68949558) has the molecular formula C18H18FNO7S and a molecular weight of 411.41 g/mol. Its IUPAC name is 2-[2-[(4-fluorophenyl)methylsulfonyl]-2-nitroethenyl]-1,3,5-trimethoxybenzene.
| Compound Name | 2-[2-[(4-fluorophenyl)methylsulfonyl]-2-nitroethenyl]-1,3,5-trimethoxybenzene |
|---|---|
| PubChem CID | 68949558 |
| Molecular Formula | C18H18FNO7S |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 2-[2-[(4-fluorophenyl)methylsulfonyl]-2-nitroethenyl]-1,3,5-trimethoxybenzene |
| SMILES | COc1cc(OC)c(C=C([N+](=O)[O-])S(=O)(=O)Cc2ccc(F)cc2)c(OC)c1 |
| InChI | InChI=1S/C18H18FNO7S/c1-25-14-8-16(26-2)15(17(9-14)27-3)10-18(20(21)22)28(23,24)11-12-4-6-13(19)7-5-12/h4-10H,11H2,1-3H3 |
| InChIKey | GQVYPGITPICCOR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|