C10H17N3O6S — CID 135618143
[amino(azaniumylidene)methyl]-[(3,4-dimethoxyphenyl)methyl]azanium sulfate (PubChem CID 135618143) has the molecular formula C10H17N3O6S and a molecular weight of 307.33 g/mol. Its IUPAC name is [amino(azaniumylidene)methyl]-[(3,4-dimethoxyphenyl)methyl]azanium sulfate.
| Compound Name | [amino(azaniumylidene)methyl]-[(3,4-dimethoxyphenyl)methyl]azanium sulfate |
|---|---|
| PubChem CID | 135618143 |
| Molecular Formula | C10H17N3O6S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | [amino(azaniumylidene)methyl]-[(3,4-dimethoxyphenyl)methyl]azanium sulfate |
| SMILES | COc1ccc(C[NH2+]C(N)=[NH2+])cc1OC.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C10H15N3O2.H2O4S/c1-14-8-4-3-7(5-9(8)15-2)6-13-10(11)12;1-5(2,3)4/h3-5H,6H2,1-2H3,(H4,11,12,13);(H2,1,2,3,4) |
| InChIKey | UVZQAUJJKCITGP-UHFFFAOYSA-N |
| XLogP | -3.50 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|