C15H12BrNO2S2 — CID 68943037
(Z)-2-[(4-bromophenyl)methylsulfonyl]-3-(5-methylthiophen-2-yl)prop-2-enenitrile (PubChem CID 68943037) has the molecular formula C15H12BrNO2S2 and a molecular weight of 382.30 g/mol. Its IUPAC name is (Z)-2-[(4-bromophenyl)methylsulfonyl]-3-(5-methylthiophen-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-[(4-bromophenyl)methylsulfonyl]-3-(5-methylthiophen-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 68943037 |
| Molecular Formula | C15H12BrNO2S2 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 380.95 |
| IUPAC Name | (Z)-2-[(4-bromophenyl)methylsulfonyl]-3-(5-methylthiophen-2-yl)prop-2-enenitrile |
| SMILES | Cc1ccc(/C=C(/C#N)S(=O)(=O)Cc2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C15H12BrNO2S2/c1-11-2-7-14(20-11)8-15(9-17)21(18,19)10-12-3-5-13(16)6-4-12/h2-8H,10H2,1H3/b15-8- |
| InChIKey | UNOMSKUPBQLSAZ-NVNXTCNLSA-N |
| XLogP | 4.30 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|